C17H30N2O4 — CID 143479230
3,4-dihydro-1H-isoquinoline-2-carbaldehyde;2,3-dihydroxypropanamide;ethane (PubChem CID 143479230) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinoline-2-carbaldehyde;2,3-dihydroxypropanamide;ethane.
| Compound Name | 3,4-dihydro-1H-isoquinoline-2-carbaldehyde;2,3-dihydroxypropanamide;ethane |
|---|---|
| PubChem CID | 143479230 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3,4-dihydro-1H-isoquinoline-2-carbaldehyde;2,3-dihydroxypropanamide;ethane |
| SMILES | CC.CC.NC(=O)C(O)CO.O=CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H11NO.C3H7NO3.2C2H6/c12-8-11-6-5-9-3-1-2-4-10(9)7-11;4-3(7)2(6)1-5;2*1-2/h1-4,8H,5-7H2;2,5-6H,1H2,(H2,4,7);2*1-2H3 |
| InChIKey | URQBCCQRVMPDLU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|