About 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline
2-methylsulfanyl-3,4-dihydro-1H-isoquinoline (PubChem CID 91067326) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 91067326 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CSN1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H13NS/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-5H,6-8H2,1H3 |
| InChIKey | FQKYUCQAWGJNPV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline (CID 91067326) is 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline is CSN1CCc2ccccc2C1.
What is the InChIKey of 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is FQKYUCQAWGJNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-5H,6-8H2,1H3.
What are the key properties of 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline?
2-methylsulfanyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 179.29 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 91067326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).