C14H21NS — CID 168998013
6-butyl-2-methylsulfanyl-3,4-dihydro-1H-isoquinoline (PubChem CID 168998013) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is 6-butyl-2-methylsulfanyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6-butyl-2-methylsulfanyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 168998013 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-butyl-2-methylsulfanyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCCc1ccc2c(c1)CCN(SC)C2 |
| InChI | InChI=1S/C14H21NS/c1-3-4-5-12-6-7-14-11-15(16-2)9-8-13(14)10-12/h6-7,10H,3-5,8-9,11H2,1-2H3 |
| InChIKey | DTCZGUMFQJZLIU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|