C11H14 — CID 59134563
3-propylbicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 59134563) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is 3-propylbicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-propylbicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 59134563 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 3-propylbicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | CCCc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C11H14/c1-2-3-9-4-5-10-6-7-11(10)8-9/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | MKKQLFUMEBHASB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |