C16H24 — CID 169195757
ethane;(7Z)-3-ethyl-5,6,9,10-tetrahydrobenzo[8]annulene (PubChem CID 169195757) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is ethane;(7Z)-3-ethyl-5,6,9,10-tetrahydrobenzo[8]annulene.
| Compound Name | ethane;(7Z)-3-ethyl-5,6,9,10-tetrahydrobenzo[8]annulene |
|---|---|
| PubChem CID | 169195757 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | ethane;(7Z)-3-ethyl-5,6,9,10-tetrahydrobenzo[8]annulene |
| SMILES | CC.CCc1ccc2c(c1)CC/C=C\CC2 |
| InChI | InChI=1S/C14H18.C2H6/c1-2-12-9-10-13-7-5-3-4-6-8-14(13)11-12;1-2/h3-4,9-11H,2,5-8H2,1H3;1-2H3/b4-3-; |
| InChIKey | YWAXCBAMVQIWJI-LNKPDPKZSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|