C13H16 — CID 139900760
2-ethyl-8,9-dihydro-5H-benzo[7]annulene (PubChem CID 139900760) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-ethyl-8,9-dihydro-5H-benzo[7]annulene.
| Compound Name | 2-ethyl-8,9-dihydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 139900760 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-ethyl-8,9-dihydro-5H-benzo[7]annulene |
| SMILES | CCc1ccc2c(c1)CCC=CC2 |
| InChI | InChI=1S/C13H16/c1-2-11-8-9-12-6-4-3-5-7-13(12)10-11/h3-4,8-10H,2,5-7H2,1H3 |
| InChIKey | QYWOIPUPOUNLQE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|