About 2-ethyl-8,9-dihydro-5H-benzo[7]annulene
2-ethyl-8,9-dihydro-5H-benzo[7]annulene (PubChem CID 139900760) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-ethyl-8,9-dihydro-5H-benzo[7]annulene.
Molecular Properties
| Compound Name | 2-ethyl-8,9-dihydro-5H-benzo[7]annulene |
| PubChem CID | 139900760 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-ethyl-8,9-dihydro-5H-benzo[7]annulene |
| SMILES | CCc1ccc2c(c1)CCC=CC2 |
| InChI | InChI=1S/C13H16/c1-2-11-8-9-12-6-4-3-5-7-13(12)10-11/h3-4,8-10H,2,5-7H2,1H3 |
| InChIKey | QYWOIPUPOUNLQE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-8,9-dihydro-5H-benzo[7]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-8,9-dihydro-5H-benzo[7]annulene?
The IUPAC name of 2-ethyl-8,9-dihydro-5H-benzo[7]annulene (CID 139900760) is 2-ethyl-8,9-dihydro-5H-benzo[7]annulene.
What is the SMILES notation for 2-ethyl-8,9-dihydro-5H-benzo[7]annulene?
The canonical SMILES for 2-ethyl-8,9-dihydro-5H-benzo[7]annulene is CCc1ccc2c(c1)CCC=CC2.
What is the InChIKey of 2-ethyl-8,9-dihydro-5H-benzo[7]annulene?
The InChIKey is QYWOIPUPOUNLQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16/c1-2-11-8-9-12-6-4-3-5-7-13(12)10-11/h3-4,8-10H,2,5-7H2,1H3.
What are the key properties of 2-ethyl-8,9-dihydro-5H-benzo[7]annulene?
2-ethyl-8,9-dihydro-5H-benzo[7]annulene has a molecular weight of 172.27 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-8,9-dihydro-5H-benzo[7]annulene is sourced from PubChem (CID 139900760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).