C20H32O6 — CID 23276776
22-ethyl-3,6,9,12,15,18-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-triene (PubChem CID 23276776) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 22-ethyl-3,6,9,12,15,18-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-triene.
| Compound Name | 22-ethyl-3,6,9,12,15,18-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-triene |
|---|---|
| PubChem CID | 23276776 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 22-ethyl-3,6,9,12,15,18-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-triene |
| SMILES | CCc1ccc2c(c1)COCCOCCOCCOCCOCCOC2 |
| InChI | InChI=1S/C20H32O6/c1-2-18-3-4-19-16-25-13-11-23-9-7-21-5-6-22-8-10-24-12-14-26-17-20(19)15-18/h3-4,15H,2,5-14,16-17H2,1H3 |
| InChIKey | GMGAQQFLRNNBIG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |