About N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine
N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine (PubChem CID 115922539) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine.
Molecular Properties
| Compound Name | N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine |
| PubChem CID | 115922539 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine |
| SMILES | CCC(CC)Nc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C13H19NO/c1-3-12(4-2)14-13-6-5-10-8-15-9-11(10)7-13/h5-7,12,14H,3-4,8-9H2,1-2H3 |
| InChIKey | GHCUOUWPANHCCE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine?
The IUPAC name of N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine (CID 115922539) is N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine.
What is the SMILES notation for N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine?
The canonical SMILES for N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine is CCC(CC)Nc1ccc2c(c1)COC2.
What is the InChIKey of N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine?
The InChIKey is GHCUOUWPANHCCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-3-12(4-2)14-13-6-5-10-8-15-9-11(10)7-13/h5-7,12,14H,3-4,8-9H2,1-2H3.
What are the key properties of N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine?
N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine has a molecular weight of 205.30 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine is sourced from PubChem (CID 115922539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).