C13H19NO — CID 115922539
N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine (PubChem CID 115922539) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine.
| Compound Name | N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine |
|---|---|
| PubChem CID | 115922539 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-pentan-3-yl-1,3-dihydro-2-benzofuran-5-amine |
| SMILES | CCC(CC)Nc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C13H19NO/c1-3-12(4-2)14-13-6-5-10-8-15-9-11(10)7-13/h5-7,12,14H,3-4,8-9H2,1-2H3 |
| InChIKey | GHCUOUWPANHCCE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |