C11H16N2O — CID 105281849
1-(1,3-dihydro-2-benzofuran-5-yl)propylhydrazine (PubChem CID 105281849) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)propylhydrazine.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)propylhydrazine |
|---|---|
| PubChem CID | 105281849 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)propylhydrazine |
| SMILES | CCC(NN)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C11H16N2O/c1-2-11(13-12)8-3-4-9-6-14-7-10(9)5-8/h3-5,11,13H,2,6-7,12H2,1H3 |
| InChIKey | XDWDEISTAXSYGG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|