C13H16N2O — CID 105307835
1-(1,3-dihydro-2-benzofuran-5-yl)pent-4-ynylhydrazine (PubChem CID 105307835) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)pent-4-ynylhydrazine.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)pent-4-ynylhydrazine |
|---|---|
| PubChem CID | 105307835 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)pent-4-ynylhydrazine |
| SMILES | C#CCCC(NN)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C13H16N2O/c1-2-3-4-13(15-14)10-5-6-11-8-16-9-12(11)7-10/h1,5-7,13,15H,3-4,8-9,14H2 |
| InChIKey | GFKXREMUOUMLOQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|