C13H20N4O — CID 114262951
1-amino-2-butyl-3-(1,3-dihydro-2-benzofuran-5-yl)guanidine (PubChem CID 114262951) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-amino-2-butyl-3-(1,3-dihydro-2-benzofuran-5-yl)guanidine.
| Compound Name | 1-amino-2-butyl-3-(1,3-dihydro-2-benzofuran-5-yl)guanidine |
|---|---|
| PubChem CID | 114262951 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-amino-2-butyl-3-(1,3-dihydro-2-benzofuran-5-yl)guanidine |
| SMILES | CCCC/N=C(\NN)Nc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C13H20N4O/c1-2-3-6-15-13(17-14)16-12-5-4-10-8-18-9-11(10)7-12/h4-5,7H,2-3,6,8-9,14H2,1H3,(H2,15,16,17) |
| InChIKey | LJRLLUKNQZXUMI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|