C14H24N4O3 — CID 116511680
1-amino-2-butyl-3-(3,4,5-trimethoxyphenyl)guanidine (PubChem CID 116511680) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-amino-2-butyl-3-(3,4,5-trimethoxyphenyl)guanidine.
| Compound Name | 1-amino-2-butyl-3-(3,4,5-trimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 116511680 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-amino-2-butyl-3-(3,4,5-trimethoxyphenyl)guanidine |
| SMILES | CCCC/N=C(\NN)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H24N4O3/c1-5-6-7-16-14(18-15)17-10-8-11(19-2)13(21-4)12(9-10)20-3/h8-9H,5-7,15H2,1-4H3,(H2,16,17,18) |
| InChIKey | OYZDUKKZKWTLFV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|