C12H16ClF3N4 — CID 116701070
1-amino-2-butyl-3-[3-chloro-5-(trifluoromethyl)phenyl]guanidine (PubChem CID 116701070) has the molecular formula C12H16ClF3N4 and a molecular weight of 308.74 g/mol. Its IUPAC name is 1-amino-2-butyl-3-[3-chloro-5-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1-amino-2-butyl-3-[3-chloro-5-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 116701070 |
| Molecular Formula | C12H16ClF3N4 |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-amino-2-butyl-3-[3-chloro-5-(trifluoromethyl)phenyl]guanidine |
| SMILES | CCCC/N=C(\NN)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16ClF3N4/c1-2-3-4-18-11(20-17)19-10-6-8(12(14,15)16)5-9(13)7-10/h5-7H,2-4,17H2,1H3,(H2,18,19,20) |
| InChIKey | QTHTUTRAVQJJBE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|