C13H16ClF3N2O — CID 116699866
2-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-2-ethylbutanamide (PubChem CID 116699866) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-2-ethylbutanamide.
| Compound Name | 2-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 116699866 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-2-ethylbutanamide |
| SMILES | CCC(N)(CC)C(=O)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16ClF3N2O/c1-3-12(18,4-2)11(20)19-10-6-8(13(15,16)17)5-9(14)7-10/h5-7H,3-4,18H2,1-2H3,(H,19,20) |
| InChIKey | KIFBQZIDVMCAEG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |