C13H12ClF3N2O — CID 116699929
N-[3-chloro-5-(trifluoromethyl)phenyl]-2-cyano-2-methylbutanamide (PubChem CID 116699929) has the molecular formula C13H12ClF3N2O and a molecular weight of 304.70 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)phenyl]-2-cyano-2-methylbutanamide.
| Compound Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-2-cyano-2-methylbutanamide |
|---|---|
| PubChem CID | 116699929 |
| Molecular Formula | C13H12ClF3N2O |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-2-cyano-2-methylbutanamide |
| SMILES | CCC(C)(C#N)C(=O)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12ClF3N2O/c1-3-12(2,7-18)11(20)19-10-5-8(13(15,16)17)4-9(14)6-10/h4-6H,3H2,1-2H3,(H,19,20) |
| InChIKey | LNPCBSPZYKKKJY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |