C11H7ClF3N3OS — CID 135079493
3-[3-chloro-5-(trifluoromethyl)anilino]-2-cyano-3-sulfanylidenepropanamide (PubChem CID 135079493) has the molecular formula C11H7ClF3N3OS and a molecular weight of 321.71 g/mol. Its IUPAC name is 3-[3-chloro-5-(trifluoromethyl)anilino]-2-cyano-3-sulfanylidenepropanamide.
| Compound Name | 3-[3-chloro-5-(trifluoromethyl)anilino]-2-cyano-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 135079493 |
| Molecular Formula | C11H7ClF3N3OS |
| Molecular Weight | 321.71 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 3-[3-chloro-5-(trifluoromethyl)anilino]-2-cyano-3-sulfanylidenepropanamide |
| SMILES | N#CC(C(N)=O)C(=S)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7ClF3N3OS/c12-6-1-5(11(13,14)15)2-7(3-6)18-10(20)8(4-16)9(17)19/h1-3,8H,(H2,17,19)(H,18,20) |
| InChIKey | ALOLISCZLVYFGY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|