C13H12ClF3N2O — CID 116699756
4-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]cyclopent-2-ene-1-carboxamide (PubChem CID 116699756) has the molecular formula C13H12ClF3N2O and a molecular weight of 304.70 g/mol. Its IUPAC name is 4-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 116699756 |
| Molecular Formula | C13H12ClF3N2O |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)Nc2cc(Cl)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H12ClF3N2O/c14-9-4-8(13(15,16)17)5-11(6-9)19-12(20)7-1-2-10(18)3-7/h1-2,4-7,10H,3,18H2,(H,19,20) |
| InChIKey | DUHLFIDVEAMAAP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|