C12H12ClF3N2O — CID 116699316
1-[3-chloro-5-(trifluoromethyl)phenyl]-3-cyclobutylurea (PubChem CID 116699316) has the molecular formula C12H12ClF3N2O and a molecular weight of 292.69 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-cyclobutylurea.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-cyclobutylurea |
|---|---|
| PubChem CID | 116699316 |
| Molecular Formula | C12H12ClF3N2O |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-cyclobutylurea |
| SMILES | O=C(Nc1cc(Cl)cc(C(F)(F)F)c1)NC1CCC1 |
| InChI | InChI=1S/C12H12ClF3N2O/c13-8-4-7(12(14,15)16)5-10(6-8)18-11(19)17-9-2-1-3-9/h4-6,9H,1-3H2,(H2,17,18,19) |
| InChIKey | PSLWCZYGOPXSQJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |