C26H23Cl2F3N2O — CID 19935172
1-[4,4-bis(4-chlorophenyl)cyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 19935172) has the molecular formula C26H23Cl2F3N2O and a molecular weight of 507.38 g/mol. Its IUPAC name is 1-[4,4-bis(4-chlorophenyl)cyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4,4-bis(4-chlorophenyl)cyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19935172 |
| Molecular Formula | C26H23Cl2F3N2O |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 1-[4,4-bis(4-chlorophenyl)cyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)NC1CCC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H23Cl2F3N2O/c27-20-8-4-17(5-9-20)25(18-6-10-21(28)11-7-18)14-12-22(13-15-25)32-24(34)33-23-3-1-2-19(16-23)26(29,30)31/h1-11,16,22H,12-15H2,(H2,32,33,34) |
| InChIKey | GGUYNWHHDLEFRD-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |