C20H21F3N4O2 — CID 4015085
N-cyclopropyl-2-(dimethylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 4015085) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is N-cyclopropyl-2-(dimethylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | N-cyclopropyl-2-(dimethylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 4015085 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-cyclopropyl-2-(dimethylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)Nc2cccc(C(F)(F)F)c2)cc1C(=O)NC1CC1 |
| InChI | InChI=1S/C20H21F3N4O2/c1-27(2)17-9-8-15(11-16(17)18(28)24-13-6-7-13)26-19(29)25-14-5-3-4-12(10-14)20(21,22)23/h3-5,8-11,13H,6-7H2,1-2H3,(H,24,28)(H2,25,26,29) |
| InChIKey | OLGXIVDBZPEPHL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|