C23H26F3N3O2 — CID 3900992
N-[4-(dimethylamino)-3-(4-methylpiperidine-1-carbonyl)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 3900992) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-(4-methylpiperidine-1-carbonyl)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(dimethylamino)-3-(4-methylpiperidine-1-carbonyl)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3900992 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[4-(dimethylamino)-3-(4-methylpiperidine-1-carbonyl)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CC1CCN(C(=O)c2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc2N(C)C)CC1 |
| InChI | InChI=1S/C23H26F3N3O2/c1-15-9-11-29(12-10-15)22(31)19-14-18(7-8-20(19)28(2)3)27-21(30)16-5-4-6-17(13-16)23(24,25)26/h4-8,13-15H,9-12H2,1-3H3,(H,27,30) |
| InChIKey | KZVIMBGEDYTNNQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|