C23H21F3N4O2 — CID 42747627
2-(dimethylamino)-N-(pyridin-3-ylmethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 42747627) has the molecular formula C23H21F3N4O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(pyridin-3-ylmethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | 2-(dimethylamino)-N-(pyridin-3-ylmethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 42747627 |
| Molecular Formula | C23H21F3N4O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-(dimethylamino)-N-(pyridin-3-ylmethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C23H21F3N4O2/c1-30(2)20-9-8-18(12-19(20)22(32)28-14-15-5-4-10-27-13-15)29-21(31)16-6-3-7-17(11-16)23(24,25)26/h3-13H,14H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | YKITWHLIPXEVJD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|