C21H21F6N3O3 — CID 3905630
5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(dimethylamino)-N-(2-methoxyethyl)benzamide (PubChem CID 3905630) has the molecular formula C21H21F6N3O3 and a molecular weight of 477.41 g/mol. Its IUPAC name is 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(dimethylamino)-N-(2-methoxyethyl)benzamide.
| Compound Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(dimethylamino)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 3905630 |
| Molecular Formula | C21H21F6N3O3 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(dimethylamino)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1N(C)C |
| InChI | InChI=1S/C21H21F6N3O3/c1-30(2)17-5-4-15(11-16(17)19(32)28-6-7-33-3)29-18(31)12-8-13(20(22,23)24)10-14(9-12)21(25,26)27/h4-5,8-11H,6-7H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | NYVFMPLRFDLCOU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|