C18H27N3O5 — CID 42747552
ethyl 4-[4-(dimethylamino)-3-(2-methoxyethylcarbamoyl)anilino]-4-oxobutanoate (PubChem CID 42747552) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl 4-[4-(dimethylamino)-3-(2-methoxyethylcarbamoyl)anilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-(dimethylamino)-3-(2-methoxyethylcarbamoyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42747552 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | ethyl 4-[4-(dimethylamino)-3-(2-methoxyethylcarbamoyl)anilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc(N(C)C)c(C(=O)NCCOC)c1 |
| InChI | InChI=1S/C18H27N3O5/c1-5-26-17(23)9-8-16(22)20-13-6-7-15(21(2)3)14(12-13)18(24)19-10-11-25-4/h6-7,12H,5,8-11H2,1-4H3,(H,19,24)(H,20,22) |
| InChIKey | RVHRKJYVOAJIMB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|