C22H24F3N3O3 — CID 42755996
N-(2-methoxyethyl)-2-pyrrolidin-1-yl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 42755996) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-pyrrolidin-1-yl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | N-(2-methoxyethyl)-2-pyrrolidin-1-yl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 42755996 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-(2-methoxyethyl)-2-pyrrolidin-1-yl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1N1CCCC1 |
| InChI | InChI=1S/C22H24F3N3O3/c1-31-12-9-26-21(30)18-14-17(7-8-19(18)28-10-2-3-11-28)27-20(29)15-5-4-6-16(13-15)22(23,24)25/h4-8,13-14H,2-3,9-12H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | SWYPAEGGLXUGEO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|