C22H26BrN3O3 — CID 3349119
5-[(4-bromobenzoyl)amino]-N-(2-methoxyethyl)-2-piperidin-1-ylbenzamide (PubChem CID 3349119) has the molecular formula C22H26BrN3O3 and a molecular weight of 460.37 g/mol. Its IUPAC name is 5-[(4-bromobenzoyl)amino]-N-(2-methoxyethyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(4-bromobenzoyl)amino]-N-(2-methoxyethyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3349119 |
| Molecular Formula | C22H26BrN3O3 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 5-[(4-bromobenzoyl)amino]-N-(2-methoxyethyl)-2-piperidin-1-ylbenzamide |
| SMILES | COCCNC(=O)c1cc(NC(=O)c2ccc(Br)cc2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C22H26BrN3O3/c1-29-14-11-24-22(28)19-15-18(9-10-20(19)26-12-3-2-4-13-26)25-21(27)16-5-7-17(23)8-6-16/h5-10,15H,2-4,11-14H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | CFCVGPWVZPYPNS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|