C20H24N4O5 — CID 3938181
2-(dimethylamino)-N-(3-methoxypropyl)-5-[(4-nitrobenzoyl)amino]benzamide (PubChem CID 3938181) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(3-methoxypropyl)-5-[(4-nitrobenzoyl)amino]benzamide.
| Compound Name | 2-(dimethylamino)-N-(3-methoxypropyl)-5-[(4-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 3938181 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(dimethylamino)-N-(3-methoxypropyl)-5-[(4-nitrobenzoyl)amino]benzamide |
| SMILES | COCCCNC(=O)c1cc(NC(=O)c2ccc([N+](=O)[O-])cc2)ccc1N(C)C |
| InChI | InChI=1S/C20H24N4O5/c1-23(2)18-10-7-15(13-17(18)20(26)21-11-4-12-29-3)22-19(25)14-5-8-16(9-6-14)24(27)28/h5-10,13H,4,11-12H2,1-3H3,(H,21,26)(H,22,25) |
| InChIKey | BJIFZRGQLGKQAF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|