C23H27F3N4O2 — CID 5024938
N-cyclohexyl-2-(dimethylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 5024938) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-cyclohexyl-2-(dimethylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | N-cyclohexyl-2-(dimethylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 5024938 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-cyclohexyl-2-(dimethylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | CN(C)c1ccc(NC(=O)Nc2cccc(C(F)(F)F)c2)cc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H27F3N4O2/c1-30(2)20-12-11-18(14-19(20)21(31)27-16-8-4-3-5-9-16)29-22(32)28-17-10-6-7-15(13-17)23(24,25)26/h6-7,10-14,16H,3-5,8-9H2,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | QUSYRNYJRVGNOH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|