C22H25Cl2N3O2 — CID 42747228
N-cyclohexyl-5-[(2,4-dichlorobenzoyl)amino]-2-(dimethylamino)benzamide (PubChem CID 42747228) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is N-cyclohexyl-5-[(2,4-dichlorobenzoyl)amino]-2-(dimethylamino)benzamide.
| Compound Name | N-cyclohexyl-5-[(2,4-dichlorobenzoyl)amino]-2-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 42747228 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-cyclohexyl-5-[(2,4-dichlorobenzoyl)amino]-2-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H25Cl2N3O2/c1-27(2)20-11-9-16(26-21(28)17-10-8-14(23)12-19(17)24)13-18(20)22(29)25-15-6-4-3-5-7-15/h8-13,15H,3-7H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | MUAHMQNRTDFOFK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|