C31H36Cl2N2O — CID 19935134
1-[4,4-bis(4-chlorophenyl)cyclohexyl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 19935134) has the molecular formula C31H36Cl2N2O and a molecular weight of 523.55 g/mol. Its IUPAC name is 1-[4,4-bis(4-chlorophenyl)cyclohexyl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[4,4-bis(4-chlorophenyl)cyclohexyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 19935134 |
| Molecular Formula | C31H36Cl2N2O |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 1-[4,4-bis(4-chlorophenyl)cyclohexyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC1CCC(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C31H36Cl2N2O/c1-20(2)27-6-5-7-28(21(3)4)29(27)35-30(36)34-26-16-18-31(19-17-26,22-8-12-24(32)13-9-22)23-10-14-25(33)15-11-23/h5-15,20-21,26H,16-19H2,1-4H3,(H2,34,35,36) |
| InChIKey | WAWIKGGOFJSQHR-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |