C19H23ClN2O — CID 4195925
1-(4-chlorophenyl)-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 4195925) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 4195925 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClN2O/c1-12(2)16-6-5-7-17(13(3)4)18(16)22-19(23)21-15-10-8-14(20)9-11-15/h5-13H,1-4H3,(H2,21,22,23) |
| InChIKey | MPFPKPUBRPRHCD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |