C10H10ClF3N2O — CID 116699308
1-[3-chloro-5-(trifluoromethyl)phenyl]-3-ethylurea (PubChem CID 116699308) has the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-ethylurea.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 116699308 |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10ClF3N2O/c1-2-15-9(17)16-8-4-6(10(12,13)14)3-7(11)5-8/h3-5H,2H2,1H3,(H2,15,16,17) |
| InChIKey | DGLKGSYLAICOFK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |