C12H13ClF3NOS — CID 107036182
N-[3-chloro-5-(trifluoromethyl)phenyl]-3-methyl-2-sulfanylbutanamide (PubChem CID 107036182) has the molecular formula C12H13ClF3NOS and a molecular weight of 311.76 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)phenyl]-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107036182 |
| Molecular Formula | C12H13ClF3NOS |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-3-methyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3NOS/c1-6(2)10(19)11(18)17-9-4-7(12(14,15)16)3-8(13)5-9/h3-6,10,19H,1-2H3,(H,17,18) |
| InChIKey | XMWMEYKWSJGGRP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|