C13H16ClF3N2O — CID 116699763
5-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-4-methylpentanamide (PubChem CID 116699763) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 5-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-4-methylpentanamide.
| Compound Name | 5-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 116699763 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-4-methylpentanamide |
| SMILES | CC(CN)CCC(=O)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16ClF3N2O/c1-8(7-18)2-3-12(20)19-11-5-9(13(15,16)17)4-10(14)6-11/h4-6,8H,2-3,7,18H2,1H3,(H,19,20) |
| InChIKey | VTLHMDVPUBYYLD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |