C9H9ClF3NO2S — CID 116700910
N-[3-chloro-5-(trifluoromethyl)phenyl]ethanesulfonamide (PubChem CID 116700910) has the molecular formula C9H9ClF3NO2S and a molecular weight of 287.69 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)phenyl]ethanesulfonamide.
| Compound Name | N-[3-chloro-5-(trifluoromethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 116700910 |
| Molecular Formula | C9H9ClF3NO2S |
| Molecular Weight | 287.69 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H9ClF3NO2S/c1-2-17(15,16)14-8-4-6(9(11,12)13)3-7(10)5-8/h3-5,14H,2H2,1H3 |
| InChIKey | BWUGFFUTKPQWOS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |