C14H7Cl2F6NO2S — CID 25022575
N-[3,5-bis(trifluoromethyl)phenyl]-3,5-dichlorobenzenesulfonamide (PubChem CID 25022575) has the molecular formula C14H7Cl2F6NO2S and a molecular weight of 438.18 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-3,5-dichlorobenzenesulfonamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-3,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 25022575 |
| Molecular Formula | C14H7Cl2F6NO2S |
| Molecular Weight | 438.18 g/mol |
| Exact Mass | 436.95 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-3,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H7Cl2F6NO2S/c15-9-4-10(16)6-12(5-9)26(24,25)23-11-2-7(13(17,18)19)1-8(3-11)14(20,21)22/h1-6,23H |
| InChIKey | MCIZGOQWUXVZJP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.18 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |