C8H3ClF6 — CID 2769405
1-chloro-3,5-bis(trifluoromethyl)benzene (PubChem CID 2769405) has the molecular formula C8H3ClF6 and a molecular weight of 248.55 g/mol. Its IUPAC name is 1-chloro-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-chloro-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 2769405 |
| Molecular Formula | C8H3ClF6 |
| Molecular Weight | 248.55 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 1-chloro-3,5-bis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H3ClF6/c9-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
| InChIKey | OXMBWPJFVUPOFO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |