C10H4ClF9O — CID 174890856
formyl chloride;1,3,5-tris(trifluoromethyl)benzene (PubChem CID 174890856) has the molecular formula C10H4ClF9O and a molecular weight of 346.58 g/mol. Its IUPAC name is formyl chloride;1,3,5-tris(trifluoromethyl)benzene.
| Compound Name | formyl chloride;1,3,5-tris(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 174890856 |
| Molecular Formula | C10H4ClF9O |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | formyl chloride;1,3,5-tris(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.O=CCl |
| InChI | InChI=1S/C9H3F9.CHClO/c10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16,17)18;2-1-3/h1-3H;1H |
| InChIKey | DYIDBVDIFWKVNB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|