About CID 87457276
CID 87457276 (PubChem CID 87457276) has the molecular formula C8H3AlF6
and a molecular weight of 240.08 g/mol.
Molecular Properties
| Compound Name | CID 87457276 |
| PubChem CID | 87457276 |
| Molecular Formula | C8H3AlF6 |
| Molecular Weight | 240.08 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1cc([Al])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H3F6.Al/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14;/h2-4H; |
| InChIKey | KVDADTKSEAMMFO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.08 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 87457276 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87457276?
The IUPAC name of CID 87457276 (CID 87457276) is not available.
What is the SMILES notation for CID 87457276?
The canonical SMILES for CID 87457276 is FC(F)(F)c1cc([Al])cc(C(F)(F)F)c1.
What is the InChIKey of CID 87457276?
The InChIKey is KVDADTKSEAMMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F6.Al/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14;/h2-4H;.
What are the key properties of CID 87457276?
CID 87457276 has a molecular weight of 240.08 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87457276 is sourced from PubChem (CID 87457276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).