C8H4ClF6P — CID 22415845
[3,5-bis(trifluoromethyl)phenyl]-chlorophosphane (PubChem CID 22415845) has the molecular formula C8H4ClF6P and a molecular weight of 280.54 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-chlorophosphane.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-chlorophosphane |
|---|---|
| PubChem CID | 22415845 |
| Molecular Formula | C8H4ClF6P |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-chlorophosphane |
| SMILES | FC(F)(F)c1cc(PCl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4ClF6P/c9-16-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3,16H |
| InChIKey | GWNDCUOLUIVOHP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|