About [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane
[3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane (PubChem CID 142034208) has the molecular formula C10H9ClF6S
and a molecular weight of 310.69 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane.
Analyze [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane (CID 142034208) is [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane is CC.FC(F)(F)c1cc(SCl)cc(C(F)(F)F)c1.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane?
The InChIKey is XQDKIFHPTIUWGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClF6S.C2H6/c9-16-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15;1-2/h1-3H;1-2H3.
What are the key properties of [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane?
[3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane has a molecular weight of 310.69 g/mol, XLogP of 6.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl] thiohypochlorite;ethane is sourced from PubChem (CID 142034208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).