C9H7F6NS — CID 142229144
N-[3,5-bis(trifluoromethyl)phenyl]sulfanylmethanamine (PubChem CID 142229144) has the molecular formula C9H7F6NS and a molecular weight of 275.22 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]sulfanylmethanamine.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]sulfanylmethanamine |
|---|---|
| PubChem CID | 142229144 |
| Molecular Formula | C9H7F6NS |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]sulfanylmethanamine |
| SMILES | CNSc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F6NS/c1-16-17-7-3-5(8(10,11)12)2-6(4-7)9(13,14)15/h2-4,16H,1H3 |
| InChIKey | SEQBIJPUOVCREV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|