C7H7F2NS — CID 143025103
N-(3,5-difluorophenyl)sulfanylmethanamine (PubChem CID 143025103) has the molecular formula C7H7F2NS and a molecular weight of 175.20 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)sulfanylmethanamine.
| Compound Name | N-(3,5-difluorophenyl)sulfanylmethanamine |
|---|---|
| PubChem CID | 143025103 |
| Molecular Formula | C7H7F2NS |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | N-(3,5-difluorophenyl)sulfanylmethanamine |
| SMILES | CNSc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C7H7F2NS/c1-10-11-7-3-5(8)2-6(9)4-7/h2-4,10H,1H3 |
| InChIKey | LWMMQYOZEBDBJZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|