C7H6Cl2F2Zn — CID 174706993
dichlorozinc;1,3-difluoro-5-methylbenzene (PubChem CID 174706993) has the molecular formula C7H6Cl2F2Zn and a molecular weight of 264.42 g/mol. Its IUPAC name is dichlorozinc;1,3-difluoro-5-methylbenzene.
| Compound Name | dichlorozinc;1,3-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 174706993 |
| Molecular Formula | C7H6Cl2F2Zn |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 261.91 |
| IUPAC Name | dichlorozinc;1,3-difluoro-5-methylbenzene |
| SMILES | Cc1cc(F)cc(F)c1.Cl[Zn]Cl |
| InChI | InChI=1S/C7H6F2.2ClH.Zn/c1-5-2-6(8)4-7(9)3-5;;;/h2-4H,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | GZPBECDCQADUCD-UHFFFAOYSA-L |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|