C12H6Cl2F4 — CID 159732874
1-chloro-3,5-difluorobenzene (PubChem CID 159732874) has the molecular formula C12H6Cl2F4 and a molecular weight of 297.08 g/mol. Its IUPAC name is 1-chloro-3,5-difluorobenzene.
| Compound Name | 1-chloro-3,5-difluorobenzene |
|---|---|
| PubChem CID | 159732874 |
| Molecular Formula | C12H6Cl2F4 |
| Molecular Weight | 297.08 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 1-chloro-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(Cl)c1.Fc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/2C6H3ClF2/c2*7-4-1-5(8)3-6(9)2-4/h2*1-3H |
| InChIKey | NBLPMWGGHYPFEP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.08 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |