C6H4ClF — CID 71309867
3-chloro-1-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (PubChem CID 71309867) has the molecular formula C6H4ClF and a molecular weight of 136.50 g/mol. Its IUPAC name is 3-chloro-1-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene.
| Compound Name | 3-chloro-1-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 71309867 |
| Molecular Formula | C6H4ClF |
| Molecular Weight | 136.50 g/mol |
| Exact Mass | 136.02 |
| IUPAC Name | 3-chloro-1-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| SMILES | F[13c]1[13cH][13cH][13cH][13c](Cl)[13cH]1 |
| InChI | InChI=1S/C6H4ClF/c7-5-2-1-3-6(8)4-5/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | VZHJIJZEOCBKRA-IDEBNGHGSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |