About 1-chloro-3-fluorobenzene;ethane
1-chloro-3-fluorobenzene;ethane (PubChem CID 142804083) has the molecular formula C8H10ClF
and a molecular weight of 160.62 g/mol. Its IUPAC name is 1-chloro-3-fluorobenzene;ethane.
Molecular Properties
| Compound Name | 1-chloro-3-fluorobenzene;ethane |
| PubChem CID | 142804083 |
| Molecular Formula | C8H10ClF |
| Molecular Weight | 160.62 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 1-chloro-3-fluorobenzene;ethane |
| SMILES | CC.Fc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H4ClF.C2H6/c7-5-2-1-3-6(8)4-5;1-2/h1-4H;1-2H3 |
| InChIKey | KGUKAEDELFEORZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-3-fluorobenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-fluorobenzene;ethane?
The IUPAC name of 1-chloro-3-fluorobenzene;ethane (CID 142804083) is 1-chloro-3-fluorobenzene;ethane.
What is the SMILES notation for 1-chloro-3-fluorobenzene;ethane?
The canonical SMILES for 1-chloro-3-fluorobenzene;ethane is CC.Fc1cccc(Cl)c1.
What is the InChIKey of 1-chloro-3-fluorobenzene;ethane?
The InChIKey is KGUKAEDELFEORZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClF.C2H6/c7-5-2-1-3-6(8)4-5;1-2/h1-4H;1-2H3.
What are the key properties of 1-chloro-3-fluorobenzene;ethane?
1-chloro-3-fluorobenzene;ethane has a molecular weight of 160.62 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-fluorobenzene;ethane is sourced from PubChem (CID 142804083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).