About azane;1,3-dichlorobenzene
azane;1,3-dichlorobenzene (PubChem CID 67301049) has the molecular formula C6H7Cl2N
and a molecular weight of 164.04 g/mol. Its IUPAC name is azane;1,3-dichlorobenzene.
Molecular Properties
| Compound Name | azane;1,3-dichlorobenzene |
| PubChem CID | 67301049 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.04 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | azane;1,3-dichlorobenzene |
| SMILES | Clc1cccc(Cl)c1.N |
| InChI | InChI=1S/C6H4Cl2.H3N/c7-5-2-1-3-6(8)4-5;/h1-4H;1H3 |
| InChIKey | OSLGMWFGZQDWNF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.04 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,3-dichlorobenzene?
The IUPAC name of azane;1,3-dichlorobenzene (CID 67301049) is azane;1,3-dichlorobenzene.
What is the SMILES notation for azane;1,3-dichlorobenzene?
The canonical SMILES for azane;1,3-dichlorobenzene is Clc1cccc(Cl)c1.N.
What is the InChIKey of azane;1,3-dichlorobenzene?
The InChIKey is OSLGMWFGZQDWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.H3N/c7-5-2-1-3-6(8)4-5;/h1-4H;1H3.
What are the key properties of azane;1,3-dichlorobenzene?
azane;1,3-dichlorobenzene has a molecular weight of 164.04 g/mol, XLogP of 3.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,3-dichlorobenzene is sourced from PubChem (CID 67301049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).