About butane;1,3-dichlorobenzene
butane;1,3-dichlorobenzene (PubChem CID 174455068) has the molecular formula C10H14Cl2
and a molecular weight of 205.13 g/mol. Its IUPAC name is butane;1,3-dichlorobenzene.
Molecular Properties
| Compound Name | butane;1,3-dichlorobenzene |
| PubChem CID | 174455068 |
| Molecular Formula | C10H14Cl2 |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | butane;1,3-dichlorobenzene |
| SMILES | CCCC.Clc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H4Cl2.C4H10/c7-5-2-1-3-6(8)4-5;1-3-4-2/h1-4H;3-4H2,1-2H3 |
| InChIKey | DLYQIRRLGBKITI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;1,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1,3-dichlorobenzene?
The IUPAC name of butane;1,3-dichlorobenzene (CID 174455068) is butane;1,3-dichlorobenzene.
What is the SMILES notation for butane;1,3-dichlorobenzene?
The canonical SMILES for butane;1,3-dichlorobenzene is CCCC.Clc1cccc(Cl)c1.
What is the InChIKey of butane;1,3-dichlorobenzene?
The InChIKey is DLYQIRRLGBKITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C4H10/c7-5-2-1-3-6(8)4-5;1-3-4-2/h1-4H;3-4H2,1-2H3.
What are the key properties of butane;1,3-dichlorobenzene?
butane;1,3-dichlorobenzene has a molecular weight of 205.13 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1,3-dichlorobenzene is sourced from PubChem (CID 174455068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).