About 1,3-dichlorobenzene;sulfanol
1,3-dichlorobenzene;sulfanol (PubChem CID 174381890) has the molecular formula C6H6Cl2OS
and a molecular weight of 197.09 g/mol. Its IUPAC name is 1,3-dichlorobenzene;sulfanol.
Molecular Properties
| Compound Name | 1,3-dichlorobenzene;sulfanol |
| PubChem CID | 174381890 |
| Molecular Formula | C6H6Cl2OS |
| Molecular Weight | 197.09 g/mol |
| Exact Mass | 195.95 |
| IUPAC Name | 1,3-dichlorobenzene;sulfanol |
| SMILES | Clc1cccc(Cl)c1.OS |
| InChI | InChI=1S/C6H4Cl2.H2OS/c7-5-2-1-3-6(8)4-5;1-2/h1-4H;1-2H |
| InChIKey | FFNIZNCOTXETCJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.09 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichlorobenzene;sulfanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichlorobenzene;sulfanol?
The IUPAC name of 1,3-dichlorobenzene;sulfanol (CID 174381890) is 1,3-dichlorobenzene;sulfanol.
What is the SMILES notation for 1,3-dichlorobenzene;sulfanol?
The canonical SMILES for 1,3-dichlorobenzene;sulfanol is Clc1cccc(Cl)c1.OS.
What is the InChIKey of 1,3-dichlorobenzene;sulfanol?
The InChIKey is FFNIZNCOTXETCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.H2OS/c7-5-2-1-3-6(8)4-5;1-2/h1-4H;1-2H.
What are the key properties of 1,3-dichlorobenzene;sulfanol?
1,3-dichlorobenzene;sulfanol has a molecular weight of 197.09 g/mol, XLogP of 3.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichlorobenzene;sulfanol is sourced from PubChem (CID 174381890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).